ChemNet > CAS > 3368-21-6 4-Isopropylcinnamic acid
3368-21-6 4-Isopropylcinnamic acid
| product Name |
4-Isopropylcinnamic acid |
| CAS No |
3368-21-6 |
| Synonyms |
p-Isopropylcinnamic acid; AI3-23710; Cinnamic acid, p-isopropyl-; NSC 216; 2-Propenoic acid, 3-(4-(1-methylethyl)phenyl)-; (2E)-3-[4-(1-methylethyl)phenyl]prop-2-enoate |
| Molecular Formula |
C12H13O2 |
| Molecular Weight |
189.231 |
| InChI |
InChI=1/C12H14O2/c1-9(2)11-6-3-10(4-7-11)5-8-12(13)14/h3-9H,1-2H3,(H,13,14)/p-1/b8-5+ |
| EINECS |
222-138-2 |
| Molecular Structure |
|
| Boiling point |
317°C at 760 mmHg |
| Flash point |
221.5°C |
| Vapour Pressur |
0.000167mmHg at 25°C |
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
| MSDS |
Material Safety Data Sheet
|
|