28052-84-8 DL-5-Methoxytryptophan
| product Name |
DL-5-Methoxytryptophan |
| CAS No |
28052-84-8 |
| Synonyms |
DL-5-Methoxytryptophane; 5-Methoxy-DL-tryptophan; 5-methoxytryptophan; 5-methoxy-D-tryptophan |
| Molecular Formula |
C12H14N2O3 |
| Molecular Weight |
234.2512 |
| InChI |
InChI=1/C12H14N2O3/c1-17-8-2-3-11-9(5-8)7(6-14-11)4-10(13)12(15)16/h2-3,5-6,10,14H,4,13H2,1H3,(H,15,16)/t10-/m1/s1 |
| EINECS |
248-800-0 |
| Molecular Structure |
|
| Density |
1.347g/cm3 |
| Melting point |
258-261℃ |
| Boiling point |
478.3°C at 760 mmHg |
| Refractive index |
1.663 |
| Flash point |
243.1°C |
| Vapour Pressur |
5.87E-10mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Telephone |
852-2766 2230 |
| Email |
info@greatdragon-ent-co.com |