2778-96-3 stearyl stearate
| product Name |
stearyl stearate |
| CAS No |
2778-96-3 |
| Synonyms |
stearic acid stearyl ester; octadecyl octadecanoate |
| Molecular Formula |
C36H72O2 |
| Molecular Weight |
536.9557 |
| InChI |
InChI=1/C36H72O2/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-38-36(37)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h3-35H2,1-2H3 |
| EINECS |
220-476-5 |
| Molecular Structure |
|
| Density |
0.857g/cm3 |
| Boiling point |
549.1°C at 760 mmHg |
| Refractive index |
1.457 |
| Flash point |
297°C |
| Vapour Pressur |
4.14E-12mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Telephone |
886-2-27033268 |
| Email |
sales@patechfc.com.tw |
| Address |
No.41, Alley 1, Lane 420,Kuang-Fu S.Rd. Taipei, Taiwan, R.O.C. |