2550-73-4 Pyromellitic diimide
| product Name |
Pyromellitic diimide |
| CAS No |
2550-73-4 |
| Synonyms |
Benzene-1,2,4,5-tetracarboxylic diimide; pyrrolo[3,4-f]isoindole-1,3,5,7(2H,6H)-tetrone |
| Molecular Formula |
C10H4N2O4 |
| Molecular Weight |
216.1498 |
| InChI |
InChI=1/C10H4N2O4/c13-7-3-1-4-6(10(16)12-8(4)14)2-5(3)9(15)11-7/h1-2H,(H,11,13,15)(H,12,14,16) |
| EINECS |
219-852-1 |
| Molecular Structure |
|
| Density |
1.719g/cm3 |
| Refractive index |
1.7 |
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
Featured China Suppliers
| Contact |
Mr. Wei |
| Telephone |
+86-573-82813637;82813639 |
| Email |
sales@jlightchem.com |
| Address |
Dongtang slip, Jiaxing Industrial Park, Daqiao Town, Jiaxing, Zhejiang, China. |