244-63-3 Norharman
| product Name |
Norharman |
| CAS No |
244-63-3 |
| Synonyms |
9H-Pyrido[3,4-B]Indole |
| Molecular Formula |
C11H8N2 |
| Molecular Weight |
168.1946 |
| InChI |
InChI=1/C11H8N2/c1-2-4-10-8(3-1)9-5-6-12-7-11(9)13-10/h1-7,13H |
| EINECS |
205-959-0 |
| Molecular Structure |
|
| Density |
1.301g/cm3 |
| Melting point |
198-202℃ |
| Boiling point |
391.3°C at 760 mmHg |
| Refractive index |
1.784 |
| Flash point |
182.1°C |
| Vapour Pressur |
5.62E-06mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Contact |
Mr.Yu |
| Telephone |
+86-24-31204918 |
| Email |
sales@mole-pharm.com |
| Address |
No,17-1, Wensu Street, Hunnan New Area, Shenyang City,Liaoning Privince ,China |