2058-74-4 1-Methylisatin
| product Name |
1-Methylisatin |
| CAS No |
2058-74-4 |
| Synonyms |
Methylisatintech; 1-methyl-2,3-dihydroindole-2,3-dione; N-Methylsatin; 1-Methyl-2,3-indolinedione; 1-methyl-1H-indole-2,3-dione; 1-Methylindoline-2,3-Dione |
| Molecular Formula |
C9H7NO2 |
| Molecular Weight |
161.1574 |
| InChI |
InChI=1/C9H7NO2/c1-10-7-5-3-2-4-6(7)8(11)9(10)12/h2-5H,1H3 |
| EINECS |
218-164-9 |
| Molecular Structure |
|
| Density |
1.314g/cm3 |
| Melting point |
129-133℃ |
| Boiling point |
294.3°C at 760 mmHg |
| Refractive index |
1.607 |
| Flash point |
137.4°C |
| Vapour Pressur |
0.00164mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Contact |
MR.Zhang |
| Telephone |
00852-83038667 |
| Email |
sales@hostcountry.cn |
| Address |
Room 1502, 15th Floor, SPA Centre,53-55 Lockhart Road, Wanchai, Hong Kong |