2001-93-6 Dithiouracil
| product Name |
Dithiouracil |
| CAS No |
2001-93-6 |
| Synonyms |
2,4(1H,3H)-Pyrimidinedithione; 2,4-Dithiopyrimidine; pyrimidine-2,4-dithiol; pyrimidine-2,4(1H,3H)-dithione; 2,4-dimercaptopyrimidine |
| Molecular Formula |
C4H4N2S2 |
| Molecular Weight |
144.218 |
| InChI |
InChI=1/C4H4N2S2/c7-3-1-2-5-4(8)6-3/h1-2H,(H2,5,6,7,8) |
| EINECS |
217-894-5 |
| Molecular Structure |
|
| Density |
1.5g/cm3 |
| Melting point |
279-281℃ |
| Boiling point |
225.6°C at 760 mmHg |
| Refractive index |
1.776 |
| Flash point |
90.3°C |
| Vapour Pressur |
0.0855mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Telephone |
+86-571-88902504;88902507 |
| Email |
shoufu@shoufuchem.com |
| Address |
5/F, Yangfan Venture Plaza, 31 Xincheng Road, Binjiang District, Hangzhou City, Zhejiang Province, P.R.China |