1892-31-5 Thiopropionic acid
| product Name |
Thiopropionic acid |
| CAS No |
1892-31-5 |
| Synonyms |
Propanethioic acid; propanethioic S-acid |
| Molecular Formula |
C3H6OS |
| Molecular Weight |
90.1441 |
| InChI |
InChI=1/C3H6OS/c1-2-3(4)5/h2H2,1H3,(H,4,5) |
| EINECS |
217-577-1 |
| Molecular Structure |
|
| Density |
1.01g/cm3 |
| Boiling point |
109.4°C at 760 mmHg |
| Refractive index |
1.447 |
| Flash point |
19.9°C |
| Vapour Pressur |
24.9mmHg at 25°C |
|
Featured China Suppliers
| Telephone |
+86-10-69328630 |
| Email |
sales@yzwychem.com |
| Address |
Zhuge Village( at the behind of Chengguan ST.),Fangshan Borough, Beijing City, P.R.C. |