18683-91-5 ambroxol
| product Name |
ambroxol |
| CAS No |
18683-91-5 |
| Synonyms |
AMBROXOL; 4-((2- Amino-3,5-dibromobenzyl)amino)-(e)-cyclohexano; 4-[(2-amino-3,5-dibromobenzyl)amino]cyclohexanol; trans-4-[(2-amino-3,5-dibromobenzyl)amino]cyclohexanol |
| Molecular Formula |
C13H18Br2N2O |
| Molecular Weight |
378.1028 |
| InChI |
InChI=1/C13H18Br2N2O/c14-9-5-8(13(16)12(15)6-9)7-17-10-1-3-11(18)4-2-10/h5-6,10-11,17-18H,1-4,7,16H2/t10-,11- |
| EINECS |
242-500-3 |
| Molecular Structure |
|
| Density |
1.704g/cm3 |
| Boiling point |
468.647°C at 760 mmHg |
| Refractive index |
1.654 |
| Flash point |
237.23°C |
| Vapour Pressur |
0mmHg at 25°C |
| Hazard Symbols |
Xn:Harmful;
|
| Risk Codes |
R22:;
|
| Safety Description |
S36:;
|
|
Featured China Suppliers
| Contact |
Ms linli |
| Telephone |
+86-13958038112 |
| Email |
13958038112@139.com |
| Address |
RM6421 of North Building of Zhijiang Hotel, 188-200 Moganshan Road, Hangzhou, 310005, China |
| Contact |
Wu qing |
| Telephone |
+852) 3483 7684 |
| Email |
sales@n-techem.com |
| Address |
Unit D, 6/F., Sing Ho Finance Building,166-168 Gloucester Road, Wanchai, Hong Kong |