ChemNet > CAS > 151-01-9 O-ethyl hydrogen dithiocarbonate
151-01-9 O-ethyl hydrogen dithiocarbonate
| product Name |
O-ethyl hydrogen dithiocarbonate |
| CAS No |
151-01-9 |
| Synonyms |
Ethylxanthate; 4-03-00-00401 (Beilstein Handbook Reference); BRN 1740597; Carbonic acid, dithio-, O-ethyl ester; Carbonodithioic acid, O-ethyl ester; Ethoxydithioformic acid; Ethyl xanthate; Ethyl xanthogenate; Ethylxanthic acid; Ethylxanthogenic acid; HSDB 5652; O-Ethyl dithiocarbamate; O-Ethyl dithiocarbonate; Xanthate; Xanthic acid, ethyl-; Xanthogenic acid; Xanthogenic acid, ethyl-; O-Ethyl hydrogen dithiocarbonate; O-ethyl hydrogen carbonodithioate |
| Molecular Formula |
C3H6OS2 |
| Molecular Weight |
122.2091 |
| InChI |
InChI=1/C3H6OS2/c1-2-4-3(5)6/h2H2,1H3,(H,5,6) |
| EINECS |
205-780-8 |
| Molecular Structure |
|
| Density |
1.181g/cm3 |
| Boiling point |
120.5°C at 760 mmHg |
| Refractive index |
1.548 |
| Flash point |
26.7°C |
| Vapour Pressur |
18.2mmHg at 25°C |
|
Featured China Suppliers
| Contact |
Mr. He |
| Telephone |
+86-24-74570274;+86-24-74127073;+86-24-74127072;Export sales office??+86-24-74570273;084-24-74127079;+86-24-74127078;Supply:+86-24-74570267;+86-24-74127070;+86-24-74127071;The director of the office??+86-24-74562421;+86-24-74127078 |
| Email |
tlfrf@mail.tlptt.ln.cn;hsiaobo@minefriend.com |
| Address |
No.18 Beisan Road, Tiexi Street,Yinzhou Dist., Tieling City 112002,Liaoning, China |