13304-62-6 N-Benzylacrylamide
| product Name |
N-Benzylacrylamide |
| CAS No |
13304-62-6 |
| Synonyms |
N-benzylprop-2-enamide |
| Molecular Formula |
C10H11NO |
| Molecular Weight |
161.2004 |
| InChI |
InChI=1/C10H11NO/c1-2-10(12)11-8-9-6-4-3-5-7-9/h2-7H,1,8H2,(H,11,12) |
| Molecular Structure |
|
| Density |
1.031g/cm3 |
| Boiling point |
349.6°C at 760 mmHg |
| Refractive index |
1.531 |
| Flash point |
205.3°C |
| Vapour Pressur |
4.67E-05mmHg at 25°C |
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
Featured China Suppliers
| Contact |
Mr.huang |
| Telephone |
+0086-311-85617316 85617616 |
| Email |
hesheng@china-hesheng.com |
| Address |
Yanshan Shopping Mall,No.257 Hepingdonglu,Shijiazhuang City |
| Contact |
Mr. Wei |
| Telephone |
+86-573-82813637;82813639 |
| Email |
sales@jlightchem.com |
| Address |
Dongtang slip, Jiaxing Industrial Park, Daqiao Town, Jiaxing, Zhejiang, China. |