123-04-6 2-Ethylhexyl chloride
| product Name |
2-Ethylhexyl chloride |
| CAS No |
123-04-6 |
| Synonyms |
Isooctylchloride; 1-chloro-2-ethylhexane; 3-(chloromethyl)heptane; 2-EHCL; isooctyl chloride |
| Molecular Formula |
C8H17Cl |
| Molecular Weight |
148.6736 |
| InChI |
InChI=1/C8H17Cl/c1-3-5-6-8(4-2)7-9/h8H,3-7H2,1-2H3 |
| EINECS |
204-594-4 |
| Molecular Structure |
|
| Density |
0.862g/cm3 |
| Melting point |
-70℃ |
| Boiling point |
173.4°C at 760 mmHg |
| Refractive index |
1.423 |
| Flash point |
52.5°C |
| Water solubility |
0.0503 g/L (20℃) |
| Vapour Pressur |
1.69mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:;
|
| Safety Description |
S26:;
S37/39:;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Contact |
Jane Zhang |
| Telephone |
+86-515-88706880 |
| Email |
sales@longshenchem.com |
| Address |
No.13 Weiyi Road, Aoyang Industrial Park, Funing County, Yancheng, Jiangsu, China |
| Telephone |
+86-513-85081108;80201830 |
| Email |
zhuyan1010@hotmail.com |
| Address |
2-1010 AOTELAISI NO.299, HAOXI ROAD, NANTONG, CHINA |
| Telephone |
+86-21-61066956/57/58??61043548 |
| Email |
sales@domen.com.cn |
| Address |
Rm1907, Bldg A, No.1088 Xinjinqiao Rd, Pudong, Shanghai, China |
| Specifications |
99% min |
| Packing |
25kg??50kg 200kg |
| Description |
What is the chemical of 2-Ethylhexyl chloride ? Appearance: Colorless liquid ; Assay??99%min by GC ; IR Identity: conform to standard ; HNMR?? conform to standard ; carbon spectrum: conform to standard ; Water by K. F.:0.5% max or as per the customer??s request ; Loss on drying:0.5% max. or as per the customer??s request ; boiling point: 166-168??; =================================================================== The main applications include: as an extractant for high melting point solid fats and waxes, alkylating agent, and manufacturing raw material for surfactants, and widely used in organic synthesis reactions ============================================================================== The synthesis route of chlorinated isooctane (CAS 123-04-6) is mainly based on the nucleophilic substitution reaction between isooctanol and sulfonyl chloride, which is a common method for preparing halogenated hydrocarbons. Overview of synthesis route: This reaction usually starts with isoo... |
| Contact |
Mr. Alexander Wang |
| Telephone |
+86-22-83739603 |
| Email |
sales@yuansu-reagent.com |
| Address |
No. 268, Yuliang Street, Dagang Street, Binhai New Area, Tianjin, China |