122-32-7 triolein
| product Name |
triolein |
| CAS No |
122-32-7 |
| Synonyms |
triolein (C18:1,-cis-9) sigma grade; triolein (C18:1,-cis-9) practical grade; triolein (C18:1,(cis)-9) approx. 95%; Glyceryl trioleate; Glycerine trioleate; 1,2,3-Tri(cis-9-octadecenoyl)glycerol; Glycerol trioleate; Trioleoylglycerol; propane-1,2,3-triyl (9Z,9'Z,9''Z)tris-octadec-9-enoate |
| Molecular Formula |
C57H104O6 |
| Molecular Weight |
885.4321 |
| InChI |
InChI=1/C57H104O6/c1-4-7-10-13-16-19-22-25-28-31-34-37-40-43-46-49-55(58)61-52-54(63-57(60)51-48-45-42-39-36-33-30-27-24-21-18-15-12-9-6-3)53-62-56(59)50-47-44-41-38-35-32-29-26-23-20-17-14-11-8-5-2/h25-30,54H,4-24,31-53H2,1-3H3/b28-25-,29-26-,30-27- |
| EINECS |
204-534-7 |
| Molecular Structure |
|
| Density |
0.921g/cm3 |
| Boiling point |
818.7°C at 760 mmHg |
| Refractive index |
1.477 |
| Flash point |
302.6°C |
| Vapour Pressur |
6.66E-27mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Contact |
Mr Zhang |
| Telephone |
+86-577-88799961 88795800 88799963 88799960 88799962 |
| Email |
sales@cnjxchem.com |
| Address |
Yanjiang Industry Zone ,Wenzhou,China |
| Telephone |
+86-21-61066956/57/58??61043548 |
| Email |
sales@domen.com.cn |
| Address |
Rm1907, Bldg A, No.1088 Xinjinqiao Rd, Pudong, Shanghai, China |
| Contact |
Shirley/Maddie |
| Telephone |
+86-15275461299/86-18562558750 |
| Email |
sales01@bluewaterchem.com |
| Address |
Rm 309A-1, China(Guangrao)Urban Empowderment Center, NO.817 Bingsheng Road, Guangrao County, Dongying City, Shandong Province, China. |