1200-14-2 Butylbenzaldehyde
| product Name |
Butylbenzaldehyde |
| CAS No |
1200-14-2 |
| Synonyms |
4-n-Butylbenzaldehyde; 4-butylbenzaldehyde; Benzaldehyde, 4-butyl-; p-Butylbenzaldehyde |
| Molecular Formula |
C11H14O |
| Molecular Weight |
162.2283 |
| InChI |
InChI=1/C11H14O/c1-2-3-4-10-5-7-11(9-12)8-6-10/h5-9H,2-4H2,1H3 |
| EINECS |
214-851-2 |
| Molecular Structure |
|
| Density |
0.971g/cm3 |
| Boiling point |
257.8°C at 760 mmHg |
| Refractive index |
1.533 |
| Flash point |
103.3°C |
| Vapour Pressur |
0.0142mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Telephone |
+86-21-61066956/57/58??61043548 |
| Email |
sales@domen.com.cn |
| Address |
Rm1907, Bldg A, No.1088 Xinjinqiao Rd, Pudong, Shanghai, China |