1191-41-9 ethyl linolenate
| product Name |
ethyl linolenate |
| CAS No |
1191-41-9 |
| Synonyms |
Linolenic acid ethyl ester; 9,12,15-Octadecatrienoic acid ethyl ester; ethyl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate; ethyl (9E,12E,15E)-octadeca-9,12,15-trienoate |
| Molecular Formula |
C20H34O2 |
| Molecular Weight |
306.4828 |
| InChI |
InChI=1/C20H34O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22-4-2/h5-6,8-9,11-12H,3-4,7,10,13-19H2,1-2H3/b6-5+,9-8+,12-11+ |
| EINECS |
214-734-6 |
| Molecular Structure |
|
| Density |
0.893g/cm3 |
| Boiling point |
374.4°C at 760 mmHg |
| Refractive index |
1.475 |
| Flash point |
100.7°C |
| Vapour Pressur |
8.35E-06mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|