1124-39-6 4-Ethylcatechol
| product Name |
4-Ethylcatechol |
| CAS No |
1124-39-6 |
| Synonyms |
3,4-Dihydroxyethylbenzene; 4-ethylbenzene-1,2-diol |
| Molecular Formula |
C8H10O2 |
| Molecular Weight |
138.1638 |
| InChI |
InChI=1/C8H10O2/c1-2-6-3-4-7(9)8(10)5-6/h3-5,9-10H,2H2,1H3 |
| EINECS |
214-397-5 |
| Molecular Structure |
|
| Density |
1.159g/cm3 |
| Boiling point |
273.3°C at 760 mmHg |
| Refractive index |
1.578 |
| Flash point |
134.1°C |
| Vapour Pressur |
0.00346mmHg at 25°C |
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
Featured China Suppliers
| Contact |
Jason Jing |
| Telephone |
+86-571-85586718 |
| Email |
sales@capot.com |
| Address |
Wanlun Sci Park,No.88 Jiangling RD,Hangzhou, Zhejiang, China, 310051 |