1122-60-7 nitrocyclohexane
| product Name |
nitrocyclohexane |
| CAS No |
1122-60-7 |
| Synonyms |
Hexahydronitrobenzene |
| Molecular Formula |
C6H11NO2 |
| Molecular Weight |
129.157 |
| InChI |
InChI=1/C6H11NO2/c8-7(9)6-4-2-1-3-5-6/h6H,1-5H2 |
| EINECS |
214-354-0 |
| Molecular Structure |
|
| Density |
1.05g/cm3 |
| Boiling point |
202.8°C at 760 mmHg |
| Refractive index |
1.465 |
| Flash point |
81.2°C |
| Vapour Pressur |
0.287mmHg at 25°C |
| Risk Codes |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|