1119-40-0 Dimethyl glutarate
| product Name |
Dimethyl glutarate |
| CAS No |
1119-40-0 |
| Synonyms |
dbe-5 dibasic ester; Glutaric acid dimethyl ester; Pentanedioic acid dimethyl ester; DIMETHYLE GLUTARATE; DBE-2; dimethyl pentanedioate; dimethyl glutamate; 5-methoxy-4-methyl-1H-indole |
| Molecular Formula |
C10H11NO |
| Molecular Weight |
161.2004 |
| InChI |
InChI=1/C10H11NO/c1-7-8-5-6-11-9(8)3-4-10(7)12-2/h3-6,11H,1-2H3 |
| EINECS |
214-277-2 |
| Molecular Structure |
|
| Density |
1.134g/cm3 |
| Melting point |
-37℃ |
| Boiling point |
303.3°C at 760 mmHg |
| Refractive index |
1.621 |
| Flash point |
111.2°C |
| Water solubility |
53 g/L |
| Vapour Pressur |
0.00168mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:;
|
| Safety Description |
S26:;
S36:;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Specifications |
99.0% |
| Packing |
25kg/drum |
| Description |
Dimethyl glutarate is primarily used for synthesizing high molecular weight polymers, such as polyurethane and polyester fibers. It can also serve as a softener, plasticizer, solvent, and coating additive. Additionally, dimethyl glutarate is utilized in the production of plasticizers, synthetic lubricants, and resins. |
| Contact |
Mrs. Wang |
| Telephone |
+86-15726167122 |
| Email |
sales@zsscm.com.cn |
| Address |
No.316-6,3rd Floor,New Material Trading Center,Tianqiao Jinan250031,Shandong,China |
| Telephone |
86-571-87630650 |
| Email |
sales@depewchem.com |
| Address |
6-6F??Matrix Int'l Ctr, No.515 Yuhangtang Road, Hangzhou, 310011, China |
| Contact |
Mr. Zhou |
| Telephone |
+86-574-26889102 |
| Email |
sales@jiasichem.com |
| Address |
Rm.1201,Building 7,Smart Park,No.99 Xiangyun North Road,High-tech Zone,Ningbo,Zhejiang,China 315100 |
| Contact |
Mr. Wei Fei ( Managing Director) Mrs. Lanny Cao ( Director) |
| Telephone |
+86-571-85232125;85232161;85134551 |
| Email |
info@afinechem.com;sales@afinechem.com |
| Address |
7-601 ,Xigang Xinjie, Xihu Industrial Park, Sandun Town,Hangzhou 310030, China |
| Contact |
Mr. Zheng |
| Telephone |
+86-592-2299609 |
| Email |
chem@chemtrade.cn |
| Address |
No. 8 Songyu Road, Xiamen, Fujian, China |