111-56-8 2-Bromolauric acid
| product Name |
2-Bromolauric acid |
| CAS No |
111-56-8 |
| Synonyms |
2-Bromododecanoic acid |
| Molecular Formula |
C12H23BrO2 |
| Molecular Weight |
279.2138 |
| InChI |
InChI=1/C12H23BrO2/c1-2-3-4-5-6-7-8-9-10-11(13)12(14)15/h11H,2-10H2,1H3,(H,14,15) |
| EINECS |
203-882-7 |
| Molecular Structure |
|
| Density |
1.189g/cm3 |
| Melting point |
30-32℃ |
| Boiling point |
344.8°C at 760 mmHg |
| Refractive index |
1.481 |
| Flash point |
162.3°C |
| Vapour Pressur |
1.15E-05mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|