105-56-6 Ethyl cyanoacetate
| product Name |
Ethyl cyanoacetate |
| CAS No |
105-56-6 |
| Synonyms |
Cyanoacetic acid ethyl ester; ETHYLE CYANACETATE |
| Molecular Formula |
C5H7NO2 |
| Molecular Weight |
113.1146 |
| InChI |
InChI:1S/C5H7NO2/c1-2-8-5(7)3-4-6/h2-3H2,1H3 |
| EINECS |
203-309-0 |
| Molecular Structure |
|
| Density |
1.047g/cm3 |
| Melting point |
-22℃ |
| Boiling point |
203.6°C at 760 mmHg |
| Refractive index |
1.412 |
| Flash point |
84.1°C |
| Water solubility |
20 g/L (20℃) |
| Vapour Pressur |
0.275mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/38:;
|
| Safety Description |
S26:;
S37/39:;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Packing |
200kgs net plastic drum(1x20'FCL=16mts) |
| Description |
Molecular Formula: C5H7NO2CAS Number: 105-56-6Description: mp: -22?CVapor pressure: 1 mmHg (67.8?C)Density: 1.063 g/ml at 25?Cbp: 208-210?CFp: 110?CSpecificationAppearance: colorless liquid free of contaminants Assay: 99.0% min Water: 0.05% max Acid: 0.05% max |
| Telephone |
+86-21-33927743;33927342 |
| Email |
info@hebeismart.com |
| Address |
Room 2702,Information Tower,1403 Minsheng Road,Shanghai,200135,China. |
| Telephone |
+86-25-83247442/443/445/446/447 |
| Email |
sales@levachem.com |
| Address |
2112 SuNing Universal Mansion, 188 Guangzhou Road, Nanjing 210024, China |
| Telephone |
86-576-85689892 |
| Email |
sales@wonderfult.com |
| Address |
Economy development area Yongquan, Linhai City, Zhejiang P.R. of China |
| Telephone |
+86-571-88086639 |
| Email |
info@star-chemicals.com |
| Address |
No. 810 Qinggong Building, No. 8 Wensan Road, Hangzhou, China |
| Telephone |
+86-311-86136559 |
| Email |
sales@hbmedipharm.com |
| Address |
NO.158 Zhongshan E. Rd., Binjiang Commercial Building A 11 Floor,Shijiazhuang Hebei China. |