103-82-2 Phenylacetic acid
| product Name |
Phenylacetic acid |
| CAS No |
103-82-2 |
| Synonyms |
a-Tolylic Acid; alpha-Tolylic acid; 2-Phenylacetic acid; alpha-Toluic acid; Benzeneacetic acid; 2-oxo-3-phenylpropanoic acid; sodium phenylacetate; ammonium phenylacetate; calcium bis(phenylacetate); phenylacetate; Phenoxacetic acid |
| Molecular Formula |
C8H8O2 |
| Molecular Weight |
136.1479 |
| InChI |
InChI=1/C8H8O2/c9-8(10)6-7-4-2-1-3-5-7/h1-5H,6H2,(H,9,10) |
| EINECS |
203-148-6 |
| Molecular Structure |
|
| Density |
1.165g/cm3 |
| Melting point |
75-78℃ |
| Boiling point |
265.499°C at 760 mmHg |
| Refractive index |
1.552 |
| Flash point |
156.213°C |
| Water solubility |
15 g/L (20℃) |
| Vapour Pressur |
0.005mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:;
|
| Safety Description |
S26:;
S37/39:;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Telephone |
+86-27-83831778 |
| Email |
zhangxu@chinaorganic.com |
| Address |
10 Gongnong Road ,Qiaokou District ,Wuhan,China |
| Packing |
25kg plastic woven bag with plastic inner film. |
| Description |
Chemical Name: phenylacetic acid Molecular Formula: C8H8O2 Molecular Weight: 136 Property: pure phenylacetic acid is white scale-like crystal; Melting point 76.2-78??C. slightly dissolved in water, easily dissolved in alcohol, acetone and alkali solvent; non-toxic. Appearance: white scale-like crystal Purity: 99% Melting Point: 76.2-78??C Loss on Dry: ??0.50% Solvation: passed
|
| Contact |
Mr. Edward Zhang |
| Telephone |
+86-23-67896333 |
| Email |
info@changfengchem.com |
| Address |
30th Floor, Longhu Ziduxingzuo Building, 1st Branch,YuSong Rd., Yubei District, Chongqing, China |
| Contact |
Karl |
| Telephone |
+86-571-85395792 +13867466880 |
| Email |
info@orchid-chem.com |
| Address |
R1812, 607, North Zhongshan Road, Hangzhou, Zhejiang, China |
| Telephone |
+86-555-2568883;+86-519-83293217;013801504285 |
| Email |
jvd@pyridinechem.com |
| Address |
Anhui Provincial Fine Chemical Park, Wujiang Town, Hexian, Anhui Province, China |
| Telephone |
+86-418-8229899 |
| Email |
natj@china-fluoro.com |
| Address |
5, 7th Huagong Road, Fluorineindustry development zone (Yimatu Town,Fumeng County),Fuxin City, Liaoning Province, China |