101-63-3 bis(4-nitrophenyl) ether
| product Name |
bis(4-nitrophenyl) ether |
| CAS No |
101-63-3 |
| Synonyms |
4,4-Dinitrodiphenyl ether; Ether,bis(p-nitrophenyl) (6CI,7CI,8CI); 4,4'-Dinitrodiphenyl ether; 4,4'-Dinitrodiphenyl oxide; Bis(p-nitrophenyl) ether; Di-4-nitrophenyl ether; NSC 8740; Oxybis[4-nitrobenzene]; p,p'-Dinitrodiphenylether; p-Nitrophenyl ether; 1,1'-oxybis(4-nitrobenzene) |
| Molecular Formula |
C12H8N2O5 |
| Molecular Weight |
260.2023 |
| InChI |
InChI=1/C12H8N2O5/c15-13(16)9-1-5-11(6-2-9)19-12-7-3-10(4-8-12)14(17)18/h1-8H |
| EINECS |
202-961-3 |
| Molecular Structure |
|
| Density |
1.416g/cm3 |
| Melting point |
140-145℃ |
| Boiling point |
386.2°C at 760 mmHg |
| Refractive index |
1.635 |
| Flash point |
174°C |
| Vapour Pressur |
7.99E-06mmHg at 25°C |
| Risk Codes |
R34; R36; :;
|
| Safety Description |
S26; S36/37/39; S45; :;
|
|
Featured China Suppliers
| Telephone |
0086-21-54277770 |
| Email |
contact@world-prospect.com |
| Address |
8F, Building 88, No.1199, Qinzhou North Road, Shanghai, China |
| Contact |
Mr li |
| Telephone |
+86-952-7687158 |
| Email |
sales@dehaochem.cn |
| Address |
South of Huayi Avenue, Shizuishan Economic and Technological Development Zone, Ningxia, China |