998-93-6 4-Bromoheptane
| Produkt-Name |
4-Bromoheptane |
| Englischer Name |
4-Bromoheptane;Heptane, 4-bromo- |
| Molekulare Formel |
C7H15Br |
| Molecular Weight |
179.098 |
| InChI |
InChI=1/C7H15Br/c1-3-5-7(8)6-4-2/h7H,3-6H2,1-2H3 |
| CAS Registry Number |
998-93-6 |
| EINECS |
213-653-3 |
| Molecular Structure |
|
| Dichte |
1.136g/cm3 |
| Siedepunkt |
168°C at 760 mmHg |
| Brechungsindex |
1.447 |
| Flammpunkt |
48.4°C |
| Dampfdruck |
2.18mmHg at 25°C |
| Risk Codes |
R10:Flammable.;
|
| Safety Beschreibung |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|