959-23-9 4'-Methoxychalcone
| Produkt-Name |
4'-Methoxychalcone |
| Englischer Name |
4'-Methoxychalcone; 4'-Methoxychalcone; AI3-25493; CCRIS 2231; EINECS 213-495-5; NSC 37157; 2-Propen-1-one, 1-(4-methoxyphenyl)-3-phenyl-; alpha-Styryl p-anisyl ketone; 1-(4-methoxyphenyl)-3-phenylprop-2-en-1-one; (2E)-1-(4-methoxyphenyl)-3-phenylprop-2-en-1-one |
| Molekulare Formel |
C16H14O2 |
| Molecular Weight |
238.2812 |
| InChI |
InChI=1/C16H14O2/c1-18-15-10-8-14(9-11-15)16(17)12-7-13-5-3-2-4-6-13/h2-12H,1H3/b12-7+ |
| CAS Registry Number |
959-23-9 |
| EINECS |
213-495-5 |
| Molecular Structure |
|
| Dichte |
1.114g/cm3 |
| Schmelzpunkt |
101-103℃ |
| Siedepunkt |
397.48°C at 760 mmHg |
| Brechungsindex |
1.606 |
| Flammpunkt |
180.482°C |
| Dampfdruck |
0mmHg at 25°C |
| Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|