7355-22-8 5-Bromo-§
| Produkt-Name |
5-Bromo-§ |
| Englischer Name |
5-Bromo-§ 5-Bromo-2,4-dihydroxybenzoic acid monohydrate; 5-bromo-2,4-dihydroxybenzoic acid |
| Molekulare Formel |
C7H5BrO4 |
| Molecular Weight |
233.0162 |
| InChI |
InChI=1/C7H5BrO4/c8-4-1-3(7(11)12)5(9)2-6(4)10/h1-2,9-10H,(H,11,12) |
| CAS Registry Number |
7355-22-8 |
| EINECS |
230-881-9 |
| Molecular Structure |
|
| Dichte |
2.026g/cm3 |
| Siedepunkt |
436.7°C at 760 mmHg |
| Brechungsindex |
1.703 |
| Flammpunkt |
217.9°C |
| Dampfdruck |
2.13E-08mmHg at 25°C |
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|