ChemNet > CAS > 7152-04-7 4-Acetamidocinnamic acid
7152-04-7 4-Acetamidocinnamic acid
| Produkt-Name |
4-Acetamidocinnamic acid |
| Englischer Name |
4-Acetamidocinnamic acid;(2E)-3-[4-(acetylamino)phenyl]prop-2-enoic acid |
| Molekulare Formel |
C11H11NO3 |
| Molecular Weight |
205.2099 |
| InChI |
InChI=1/C11H11NO3/c1-8(13)12-10-5-2-9(3-6-10)4-7-11(14)15/h2-7H,1H3,(H,12,13)(H,14,15)/b7-4+ |
| CAS Registry Number |
7152-04-7 |
| Molecular Structure |
|
| Dichte |
1.297g/cm3 |
| Siedepunkt |
470.9°C at 760 mmHg |
| Brechungsindex |
1.654 |
| Flammpunkt |
238.6°C |
| Dampfdruck |
1.13E-09mmHg at 25°C |
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|