623-93-8 5-Nonanol
| Produkt-Name |
5-Nonanol |
| Englischer Name |
5-Nonanol; 5-Nonanol, (Di-n-butyl carbinol); Di-n-butyl carbinol; nonan-5-ol |
| Molekulare Formel |
C9H20O |
| Molecular Weight |
144.2545 |
| InChI |
InChI=1/C9H20O/c1-3-5-7-9(10)8-6-4-2/h9-10H,3-8H2,1-2H3 |
| CAS Registry Number |
623-93-8 |
| EINECS |
210-820-2 |
| Molecular Structure |
|
| Dichte |
0.824g/cm3 |
| Siedepunkt |
196.6°C at 760 mmHg |
| Brechungsindex |
1.43 |
| Flammpunkt |
79.5°C |
| Dampfdruck |
0.102mmHg at 25°C |
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|