607-28-3 Isatin-3-oxime
| Produkt-Name |
Isatin-3-oxime |
| Englischer Name |
Isatin-3-oxime; 3-hydroxyiminoindolin-2-one; beta-Isatoxime; 3-(hydroxyamino)-2H-indol-2-one |
| Molekulare Formel |
C8H6N2O2 |
| Molecular Weight |
162.1454 |
| InChI |
InChI=1/C8H6N2O2/c11-8-7(10-12)5-3-1-2-4-6(5)9-8/h1-4,12H,(H,9,10,11) |
| CAS Registry Number |
607-28-3 |
| EINECS |
210-132-2 |
| Molecular Structure |
|
| Dichte |
1.49g/cm3 |
| Schmelzpunkt |
210-214℃ |
| Siedepunkt |
400.5°C at 760 mmHg |
| Brechungsindex |
1.706 |
| Flammpunkt |
196°C |
| Dampfdruck |
4.43E-08mmHg at 25°C |
| Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|