6047-91-2 2-Furylglyoxylonitrile
| Produkt-Name |
2-Furylglyoxylonitrile |
| Englischer Name |
2-Furylglyoxylonitrile; 2-Furoyl cyanide; Furylglyoxylonitrile; alpha-Oxo-2-furanacetonitrile; furan-2-yl(oxo)acetonitrile |
| Molekulare Formel |
C6H3NO2 |
| Molecular Weight |
121.0935 |
| InChI |
InChI=1/C6H3NO2/c7-4-5(8)6-2-1-3-9-6/h1-3H |
| CAS Registry Number |
6047-91-2 |
| EINECS |
227-944-8 |
| Molecular Structure |
|
| Dichte |
1.246g/cm3 |
| Schmelzpunkt |
19-87℃ |
| Siedepunkt |
175.8°C at 760 mmHg |
| Brechungsindex |
1.498 |
| Flammpunkt |
60.1°C |
| Dampfdruck |
1.13mmHg at 25°C |
| Gefahrensymbole |
Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Beschreibung |
S36/37:Wear suitable protective clothing and gloves.;
|
|