ChemNet > CAS > 5392-12-1 2-Methoxy-1-naphthaldehyde
5392-12-1 2-Methoxy-1-naphthaldehyde
| Produkt-Name |
2-Methoxy-1-naphthaldehyde |
| Englischer Name |
2-Methoxy-1-naphthaldehyde; 2-Methoxy-1-naphthylaldehyde; NSC 28471; NSC 3256; 2-methoxynaphthalene-1-carbaldehyde |
| Molekulare Formel |
C12H10O2 |
| Molecular Weight |
186.2066 |
| InChI |
InChI=1/C12H10O2/c1-14-12-7-6-9-4-2-3-5-10(9)11(12)8-13/h2-8H,1H3 |
| CAS Registry Number |
5392-12-1 |
| EINECS |
226-392-5 |
| Molecular Structure |
|
| Dichte |
1.169g/cm3 |
| Schmelzpunkt |
81-84℃ |
| Siedepunkt |
339.1°C at 760 mmHg |
| Brechungsindex |
1.642 |
| Flammpunkt |
167.4°C |
| Dampfdruck |
9.39E-05mmHg at 25°C |
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|