5344-88-7 Benzil monohydrazone
| Produkt-Name |
Benzil monohydrazone |
| Englischer Name |
Benzil monohydrazone; hydrazonodeoxybenzoin; (1E)-1,2-diphenylethane-1,2-dione 1-hydrazone
; 2-hydrazinylidene-1,2-diphenylethanone; 1-[(4-chlorobenzyl)sulfinyl]-3-phenoxypropan-2-ol; (2Z)-2-hydrazono-1,2-diphenylethanone; (2E)-2-hydrazono-1,2-diphenylethanone |
| Molekulare Formel |
C14H12N2O |
| Molecular Weight |
224.2579 |
| InChI |
InChI=1/C14H12N2O/c15-16-13(11-7-3-1-4-8-11)14(17)12-9-5-2-6-10-12/h1-10H,15H2/b16-13+ |
| CAS Registry Number |
5344-88-7 |
| EINECS |
226-292-1 |
| Molecular Structure |
|
| Dichte |
1.12g/cm3 |
| Schmelzpunkt |
147-151℃ |
| Siedepunkt |
390.7°C at 760 mmHg |
| Brechungsindex |
1.594 |
| Flammpunkt |
190.1°C |
| Dampfdruck |
2.6E-06mmHg at 25°C |
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|