523-31-9 dibenzyl phthalate
| Produkt-Name |
dibenzyl phthalate |
| Englischer Name |
dibenzyl phthalate; Dibenzyl phthalate, (Phthalic acid dibenzyl ester); Phthalic acid dibenzyl ester; dibenzyl benzene-1,3-dicarboxylate |
| Molekulare Formel |
C22H18O4 |
| Molecular Weight |
346.3759 |
| InChI |
InChI=1/C22H18O4/c23-21(25-15-17-8-3-1-4-9-17)19-12-7-13-20(14-19)22(24)26-16-18-10-5-2-6-11-18/h1-14H,15-16H2 |
| CAS Registry Number |
523-31-9 |
| EINECS |
208-344-5 |
| Molecular Structure |
|
| Dichte |
1.208g/cm3 |
| Siedepunkt |
493.8°C at 760 mmHg |
| Brechungsindex |
1.605 |
| Flammpunkt |
248.8°C |
| Dampfdruck |
6.79E-10mmHg at 25°C |
| Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|