ChemNet > CAS > 4594-78-9 2-Oxo-1-cyclohexanepropionitrile
4594-78-9 2-Oxo-1-cyclohexanepropionitrile
| Produkt-Name |
2-Oxo-1-cyclohexanepropionitrile |
| Englischer Name |
2-Oxo-1-cyclohexanepropionitrile; 2-Oxocyclohexanepropiononitrile; AI3-33245; Cyclohexanepropanenitrile, 2-oxo-; 3-(2-oxocyclohexyl)propanenitrile; 3-[(1R)-2-oxocyclohexyl]propanenitrile; 3-[(1S)-2-oxocyclohexyl]propanenitrile; 2-(Beta-Cyanoethyl)cyclohexanone |
| Molekulare Formel |
C9H13NO |
| Molecular Weight |
151.2056 |
| InChI |
InChI=1/C9H13NO/c10-7-3-5-8-4-1-2-6-9(8)11/h8H,1-6H2/t8-/m0/s1 |
| CAS Registry Number |
4594-78-9 |
| EINECS |
224-991-6 |
| Molecular Structure |
|
| Dichte |
1.005g/cm3 |
| Siedepunkt |
276.3°C at 760 mmHg |
| Brechungsindex |
1.466 |
| Flammpunkt |
135.6°C |
| Dampfdruck |
0.00485mmHg at 25°C |
| Gefahrensymbole |
Xn:Harmful;
|
| Risk Codes |
R20/21:Harmful by inhalation and in contact with skin.;
|
| Safety Beschreibung |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|