ChemNet > CAS > 452-64-2 1,2-Dimethyl-4-fluorobenzene
452-64-2 1,2-Dimethyl-4-fluorobenzene
| Produkt-Name |
1,2-Dimethyl-4-fluorobenzene |
| Englischer Name |
1,2-Dimethyl-4-fluorobenzene; Fluoroxylene2; Fluorooxylene; 3,4-Dimethylfluorobenzene; 4-(Trifluoromethyl)-o-xylene; 4-fluoro-1,2-dimethylbenzene; 1-fluoro-2,4-dimethylbenzene; 4-Fluoro-o-xylene |
| Molekulare Formel |
C8H9F |
| Molecular Weight |
124.1555 |
| InChI |
InChI=1/C8H9F/c1-6-3-4-8(9)7(2)5-6/h3-5H,1-2H3 |
| CAS Registry Number |
452-64-2 |
| Molecular Structure |
|
| Dichte |
0.984g/cm3 |
| Siedepunkt |
144.62°C at 760 mmHg |
| Brechungsindex |
1.481 |
| Flammpunkt |
30.873°C |
| Dampfdruck |
6.357mmHg at 25°C |
| Gefahrensymbole |
Xi:Irritant;
|
| Risk Codes |
R10:Flammable.;
|
| Safety Beschreibung |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|