ChemNet > CAS > 4472-41-7 N,N-Dimethylformamide-d7
4472-41-7 N,N-Dimethylformamide-d7
| Produkt-Name |
N,N-Dimethylformamide-d7 |
| Englischer Name |
N,N-Dimethylformamide-d7; Dimethylformamidedisotopicpurity; N,N-bis[(~2~H_3_)methyl](~2~H)formamide; N,N-bis[(~2~H_3_)methyl]formamide |
| Molekulare Formel |
C3HD6NO |
| Molecular Weight |
79.1308 |
| InChI |
InChI=1/C3H7NO/c1-4(2)3-5/h3H,1-2H3/i1D3,2D3 |
| CAS Registry Number |
4472-41-7 |
| EINECS |
224-745-8 |
| Molecular Structure |
|
| Dichte |
0.958g/cm3 |
| Siedepunkt |
152.999°C at 760 mmHg |
| Brechungsindex |
1.396 |
| Flammpunkt |
57.778°C |
| Dampfdruck |
3.403mmHg at 25°C |
| Gefahrensymbole |
T:Toxic;
|
| Risk Codes |
R20/21:Harmful by inhalation and in contact with skin.;
R36:Irritating to eyes.;
R61:May cause harm to the unborn child.;
|
| Safety Beschreibung |
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S53:Avoid exposure - obtain special instructions before use.;
|
|