ChemNet > CAS > 39745-40-9 5-Amino-6-chloro-2-picoline
39745-40-9 5-Amino-6-chloro-2-picoline
| Produkt-Name |
5-Amino-6-chloro-2-picoline |
| Englischer Name |
5-Amino-6-chloro-2-picoline; 3-Amino-2-chloro-6-picoline; 2-chloro-3-amino-6-methylpyridine; 2-chloro-6-methylpyridin-3-amine; 2-Chloro-6-methyl-pyridin-3-ylamine; 3-Amino-2-chloro-6-methylpyridine |
| Molekulare Formel |
C6H7ClN2 |
| Molecular Weight |
142.5862 |
| InChI |
InChI=1/C6H7ClN2/c1-4-2-3-5(8)6(7)9-4/h2-3H,8H2,1H3 |
| CAS Registry Number |
39745-40-9 |
| Molecular Structure |
|
| Dichte |
1.26g/cm3 |
| Siedepunkt |
262.3°C at 760 mmHg |
| Brechungsindex |
1.592 |
| Flammpunkt |
112.5°C |
| Dampfdruck |
0.011mmHg at 25°C |
| Gefahrensymbole |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|