ChemNet > CAS > 347-63-7 3-(3-Fluoro-4-methoxybenzoyl)propionic acid
347-63-7 3-(3-Fluoro-4-methoxybenzoyl)propionic acid
| Produkt-Name |
3-(3-Fluoro-4-methoxybenzoyl)propionic acid |
| Englischer Name |
3-(3-Fluoro-4-methoxybenzoyl)propionic acid; |
| Molekulare Formel |
C11H11FO4 |
| Molecular Weight |
226.20 |
| InChI |
InChI=1/C11H11FO4/c1-16-10-4-2-7(6-8(10)12)9(13)3-5-11(14)15/h2,4,6H,3,5H2,1H3,(H,14,15) |
| CAS Registry Number |
347-63-7 |
| EINECS |
206-474-7 |
| Molecular Structure |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|