ChemNet > CAS > 31377-23-8 1-Adamantanamine sulfate
31377-23-8 1-Adamantanamine sulfate
| Produkt-Name |
1-Adamantanamine sulfate |
| Englischer Name |
1-Adamantanamine sulfate; 1-Aminoadamantansulfate; Amantadine Sulphate; Amantadine Sulfate; tricyclo[3.3.1.1~3,7~]decan-1-amine sulfate (2:1); tricyclo[3.3.1.1~3,7~]decan-1-amine sulfate |
| Molekulare Formel |
C10H19NO4S |
| Molecular Weight |
249.3272 |
| InChI |
InChI=1/C10H17N.H2O4S/c11-10-4-7-1-8(5-10)3-9(2-7)6-10;1-5(2,3)4/h7-9H,1-6,11H2;(H2,1,2,3,4) |
| CAS Registry Number |
31377-23-8 |
| EINECS |
250-604-5 |
| Molecular Structure |
|
| Schmelzpunkt |
300℃ |
| Siedepunkt |
225.7°C at 760 mmHg |
| Flammpunkt |
96°C |
| Dampfdruck |
0.0852mmHg at 25°C |
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|