ChemNet > CAS > 2564-95-6 NN-Dimethylsuccinamic Acid
2564-95-6 NN-Dimethylsuccinamic Acid
| Produkt-Name |
NN-Dimethylsuccinamic Acid |
| Englischer Name |
NN-Dimethylsuccinamic Acid; N,N-Dimethylsuccinamic acid; Butanedioic acid mono(N,N-dimethylamide); 4-(dimethylamino)-4-oxobutanoic acid; 4-(dimethylamino)-4-oxobutanoate |
| Molekulare Formel |
C6H10NO3 |
| Molecular Weight |
144.149 |
| InChI |
InChI=1/C6H11NO3/c1-7(2)5(8)3-4-6(9)10/h3-4H2,1-2H3,(H,9,10)/p-1 |
| CAS Registry Number |
2564-95-6 |
| Molecular Structure |
|
| Siedepunkt |
297.5°C at 760 mmHg |
| Flammpunkt |
133.7°C |
| Dampfdruck |
0.000321mmHg at 25°C |
| Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|