| Produkt-Name |
Melamine Pyrophosphate |
| Englischer Name |
Melamine Pyrophosphate; Diphosphoric acid, compd. with 1,3,5-triazine-2,4,6-triamine (1:?); Diphosphoric acid, compd. with 1,3,5-triazine-2,4,6-triamine; Melamine, compd. with diphosphoric acid; Diphosphoric acid, compound with 1,3,5-triazine-2,4,6-triamine; diphosphoric acid - 1,3,5-triazine-2,4,6-triamine (1:1) |
| Molekulare Formel |
C3H10N6O7P2 |
| Molecular Weight |
304.095 |
| InChI |
InChI=1/C3H6N6.H4O7P2/c4-1-7-2(5)9-3(6)8-1;1-8(2,3)7-9(4,5)6/h(H6,4,5,6,7,8,9);(H2,1,2,3)(H2,4,5,6) |
| CAS Registry Number |
15541-60-3 |
| EINECS |
239-590-1 |
| Molecular Structure |
|
| Siedepunkt |
557.5°C at 760 mmHg |
| Flammpunkt |
325.3°C |
| Dampfdruck |
1.82E-12mmHg at 25°C |
|