ChemNet > CAS > 128495-46-5 4-Fluoro-3-methoxybenzaldehyde
128495-46-5 4-Fluoro-3-methoxybenzaldehyde
| Produkt-Name |
4-Fluoro-3-methoxybenzaldehyde |
| Englischer Name |
4-Fluoro-3-methoxybenzaldehyde; 4-Fluoro-m-anisaldehyde; 3-Methoxy-4-Fluorobenzaldehyde |
| Molekulare Formel |
C8H7FO2 |
| Molecular Weight |
154.1384 |
| InChI |
InChI=1/C8H7FO2/c1-11-8-4-6(5-10)2-3-7(8)9/h2-5H,1H3 |
| CAS Registry Number |
128495-46-5 |
| Molecular Structure |
|
| Dichte |
1.192g/cm3 |
| Schmelzpunkt |
61-63℃ |
| Siedepunkt |
246.3°C at 760 mmHg |
| Brechungsindex |
1.525 |
| Flammpunkt |
99.8°C |
| Dampfdruck |
0.0273mmHg at 25°C |
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|