1113-63-9 2-Methylmalonodiamide
| Produkt-Name |
2-Methylmalonodiamide |
| Englischer Name |
2-Methylmalonodiamide; 2-Methylpropanediamide; 2-Methylmalonamide |
| Molekulare Formel |
C4H8N2O2 |
| Molecular Weight |
116.1185 |
| InChI |
InChI=1/C4H8N2O2/c1-2(3(5)7)4(6)8/h2H,1H3,(H2,5,7)(H2,6,8) |
| CAS Registry Number |
1113-63-9 |
| Molecular Structure |
|
| Dichte |
1.202g/cm3 |
| Siedepunkt |
400.3°C at 760 mmHg |
| Brechungsindex |
1.485 |
| Flammpunkt |
195.9°C |
| Dampfdruck |
1.28E-06mmHg at 25°C |
| Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|