1068-52-6 Sodium bromoacetate
| Produkt-Name |
Sodium bromoacetate |
| Englischer Name |
Sodium bromoacetate; Bromoacetic acid sodium salt |
| Molekulare Formel |
C2H2BrNaO2 |
| Molecular Weight |
160.9298 |
| InChI |
InChI=1/C2H3BrO2.Na/c3-1-2(4)5;/h1H2,(H,4,5);/q;+1/p-1 |
| CAS Registry Number |
1068-52-6 |
| Molecular Structure |
|
| Siedepunkt |
207°C at 760 mmHg |
| Flammpunkt |
79°C |
| Dampfdruck |
0.0929mmHg at 25°C |
| Risk Codes |
R25:Toxic if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S22:Do not inhale dust.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|