1002-84-2 n-Pentadecanoic acid
| Produkt-Name |
n-Pentadecanoic acid |
| Englischer Name |
n-Pentadecanoic acid; Pentadecanoic acid; n-Caprylic Acid Sodium Salt |
| Molekulare Formel |
C15H30O2 |
| Molecular Weight |
242.3975 |
| InChI |
InChI=1/C15H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17/h2-14H2,1H3,(H,16,17) |
| CAS Registry Number |
1002-84-2 |
| EINECS |
213-693-1 |
| Molecular Structure |
|
| Dichte |
0.895g/cm3 |
| Schmelzpunkt |
51-53℃ |
| Siedepunkt |
330.4°C at 760 mmHg |
| Brechungsindex |
1.452 |
| Flammpunkt |
149.6°C |
| Dampfdruck |
6.67E-05mmHg at 25°C |
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|