| název vyrobku |
Lobeline sulfate |
| Anglicky název |
Lobeline sulfate; L-lobeline hemisulfate; lobeline sulphate; (2R,6R)-2-[(2S)-2-hydroxy-2-phenylethyl]-1-methyl-6-(2-oxo-2-phenylethyl)piperidinium; (2S,6R)-2-[(2S)-2-hydroxy-2-phenylethyl]-1-methyl-6-(2-oxo-2-phenylethyl)piperidinium; 2-{(2R,6S)-6-[(2S)-2-hydroxy-2-phenylethyl]-1-methylpiperidin-2-yl}-1-phenylethanone sulfate (salt) |
| Molekulární vzorec |
C22H29NO6S |
| Molekulová hmotnost |
435.5338 |
| InChI |
InChI=1/C22H27NO2.H2O4S/c1-23-19(15-21(24)17-9-4-2-5-10-17)13-8-14-20(23)16-22(25)18-11-6-3-7-12-18;1-5(2,3)4/h2-7,9-12,19-21,24H,8,13-16H2,1H3;(H2,1,2,3,4)/t19-,20+,21-;/m0./s1 |
| Registra?ní ?íslo CAS |
134-64-5 |
| EINECS |
205-151-8 |
| Molekulární struktura |
|
| Bod tání |
152℃ |
| Bod varu |
485.6°C at 760 mmHg |
| Bod vzplanutí |
247.5°C |
| Tlak par |
3.05E-10mmHg at 25°C |
| Symbol? nebezpe?nosti |
T:Toxic;
|
| Riziko Codes |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
| Bezpe?nostní Popis |
S28A:After contact with skin, wash immediately with plenty of water.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S38:In case of insufficient ventilation, wear suitable respiratory equipment.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|