Details for Dimethyl 4-nitrophthalate

Dimethyl 4-nitrophthalate
| Category: |
Intermediates |
|
| CAS NO: |
610-22-0 |
| EC NO: |
210-212-7 |
| Molecular Formula: |
C10H9NO6 |
| Molecular Weight: |
239.1816 |
| Specification: |
98% |
| InChI: |
InChI=1/C10H9NO6/c1-16-9(12)7-4-3-6(11(14)15)5-8(7)10(13)17-2/h3-5H,1-2H3 |
| Packing: |
25kg/drum |
| Uses: |
Intermediate of organic synthesis |
| Synonyms: |
4-Nitrophthalic Acid Dimethyl Ester;dimethyl 4-nitrobenzene-1,2-dicarboxylate;4-nitrodimethyl phthalate; |
| Molecular Structure: |
 |
if you are sourcing Dimethyl 4-nitrophthalate from China ,just feel free to inquire