Details for Dimethyl 3-nitrophthalate

Dimethyl 3-nitrophthalate
| Category: |
Intermediates |
|
| CAS NO: |
13365-26-9 |
| EC NO: |
|
| Molecular Formula: |
C10H9NO6 |
| Molecular Weight: |
239.1816 |
| Specification: |
98% |
| InChI: |
InChI=1/C10H9NO6/c1-16-9(12)6-4-3-5-7(11(14)15)8(6)10(13)17-2/h3-5H,1-2H3 |
| Packing: |
25kg/drum |
| Uses: |
Intermediate of organic synthesis |
| Synonyms: |
3-Nitrophthalic acid dimethyl ester;dimethyl 3-nitrobenzene-1,2-dicarboxylate; |
| Molecular Structure: |
 |
if you are sourcing Dimethyl 3-nitrophthalate from China ,just feel free to inquire