Details for 3-Nitro-4-methylbenzoic acid

3-Nitro-4-methylbenzoic acid
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
96-98-0 |
| EC NO: |
202-549-3 |
| Molecular Formula: |
C8H7NO4 |
| Molecular Weight: |
181.1381 |
| Specification: |
99% |
| InChI: |
InChI=1/C8H7NO4/c1-5-2-3-6(8(10)11)4-7(5)9(12)13/h2-4H,1H3,(H,10,11)/p-1 |
| Packing: |
25kg/drum |
| Uses: |
Intermediate of organic synthesis |
| Synonyms: |
3-Nitro-p-toluic acid;3-nitro-4-methyl benzoic acid;4-Methyl -3-Nitrobenzoic acid;4-methyl-3-nitro-benzoicaci;RARECHEM AL BO 1292;3-NITRO-4-METHYLBENZOIC ACID;AKOS BBS-00007715;2-NITROTOLUENE-4-CARBOXYLIC ACID;4-Methyl-3-Nitrobenzoic Acid 3-Nitro-4-Methylbenzoic Acid;4-Methyl-3-nitrobenzoicacid,99%;4-Methyl-3-nitrobenzoic;3-Nitro-p-toluylsure;4-Methy-3-nitrobenzoic acid;4-methyl-3-nitrobenzoate;3-Nitro-4-methylbenzoic aicd; |
| Molecular Structure: |
 |
if you are sourcing 3-Nitro-4-methylbenzoic acid from China ,just feel free to inquire