| Category: |
Pharmaceuticals and Biochemicals/Herbal Plant Extract |
|
| CAS NO: |
50-69-1 |
| EC NO: |
200-059-4 |
| Molecular Formula: |
C5H10O5 |
| Molecular Weight: |
150.1299 |
| Specification: |
|
| InChI: |
InChI=1/C5H10O5/c6-1-2-3(7)4(8)5(9)10-2/h2-9H,1H2/t2-,3-,4-,5-/m1/s1 |
| Packing: |
25kgs net cardboard drum |
Product description:
Synonyms: D-(-)-RiboseMolecular Formula: C5H10O5Molecular Weight: 150.13CAS Number: 50-69-1EG/EC Number: 2000594SpecificationAssay (on dried basis): 99.0% minOther saccharide: not detectableAppearance: white crystal powderMelting point: 80.0℃-90.0℃Loss on drying: 1.0% maxState of solution: 95% minSpecific rotation: -19.0皌o 21.0癛esidue on ignition: 0.5% maxHeavy metals: 10ppm maxArsenic (AS2O3): 2ppm max
|
| Synonyms: |
ribose, pure;D(-)Ribose (1.07605);D(minus)ribose cell culture tested;D-(-)-Ribose;D-Ribose;beta-D-ribofuranose;Ribose, D-; |
| Molecular Structure: |
 |