| Category: |
Pharmaceuticals and Biochemicals/Herbal Plant Extract |
|
| CAS NO: |
54-21-7 |
| EC NO: |
200-198-0 |
| Molecular Formula: |
C7H5O3Na |
| Molecular Weight: |
160.1 |
| Specification: |
|
| InChI: |
InChI=1/C7H6O3.Na/c8-6-4-2-1-3-5(6)7(9)10;/h1-4,8H,(H,9,10);/q;+1/p-1 |
| Packing: |
25kgs net cardboard drum |
Product description:
SpecificationBP 2000Appearance: white crystal thin slices or white crystal powder/ball powderAcidity: 0.2ml maxHeavy metals: 20ppm maxChloride: 200ppm maxSulphate: 600ppm maxAppearance of solution: No more than BY6, clearWater: 0.5% max Assay: 99.0-101.0%
|
| Uses: |
a kind of preservative,also a important product in oil field industry |
| Synonyms: |
sodium salicylate usp;Salicylic acid sodium salt;salicylic acid sodium;Sodium Salicylate/Salicylic acid sodium salt;Sodium sallicylate;Salicylic acid, sodium saltSodium ;o-hydroxybenzoic sodium salt;2-Hydroxybenzoic acid sodium salt; |
| Molecular Structure: |
 |